forked from pharmacome/conso
-
Notifications
You must be signed in to change notification settings - Fork 0
Files
/
Copy pathxrefs.tsv
33 lines (33 loc) · 1.34 KB
/
xrefs.tsv
1 | HBP Identifier | Database | Database Identifier |
---|---|---|---|
2 | HBP00001 | interpro | IPR001084 |
3 | HBP00002 | BEL | p(HGNC:MAPT, frag(569_591)) |
4 | HBP00003 | BEL | p(HGNC:MAPT, frag(592_621)) |
5 | HBP00004 | BEL | p(HGNC:MAPT, frag(623_653)) |
6 | HBP00005 | BEL | p(HGNC:MAPT, frag(654_685)) |
7 | HBP00019 | pubchem.compound | 46835756 |
8 | HBP00020 | pubchem.compound | 647821 |
9 | HBP00021 | drugbank | DB05263 |
10 | HBP00039 | BEL | p(MGI:Lama1, frag(2719_2730)) |
11 | HBP00050 | interpro | IPR013588 |
12 | HBP00052 | go | GO:0030122 |
13 | HBP00053 | ncbiprotein | NP_005901 |
14 | HBP00054 | ncbiprotein | NP_058525 |
15 | HBP00055 | ncbiprotein | NP_001190180 |
16 | HBP00056 | ncbiprotein | NP_058518 |
17 | HBP00057 | ncbiprotein | NP_001190181 |
18 | HBP00058 | ncbiprotein | NP_001116539 |
19 | HBP00060 | go | GO:0150076 |
20 | HBP00066 | fplx | Gamma_secretase |
21 | HBP00172 | BEL | p(HGNC:CDK5R1, frag(99_307)) |
22 | HBP00178 | sbo | SBO:0000543 |
23 | HBP00309 | pubchem | 9888248 |
24 | HBP00309 | chemspider | 8063920 |
25 | HBP00309 | inchi | InChI=1S/C14H13BrNO.HI/c1-16-9-3-2-4-13(16)10-14(17)11-5-7-12(15)8-6-11;/h2-9H,10H2,1H3;1H/q+1;/p-1 |
26 | HBP00309 | smiles | C[N+]1=CC=CC=C1CC(=O)C2=CC=C(C=C2)Br.[I-] |
27 | HBP00310 | chemspider | 4470526 |
28 | HBP00310 | pubchem | 5310985 |
29 | HBP00310 | drugbank | DB05708 |
30 | HBP00310 | inchi | InChI=1S/C19H20N2O2/c1-22-17-8-7-14(18(12-17)23-2)11-15-5-4-10-21-19(15)16-6-3-9-20-13-16/h3,6-9,11-13H,4-5,10H2,1-2H3/b15-11+ |
31 | HBP00310 | smiles | [H]\C(=C1\CCCN=C1C1=CN=CC=C1)C1=C(OC)C=C(OC)C=C1 |
32 | HBP00311 | BEL | complex(p(HGNC:CHRNA4), p(HGNC:CHRNA5), p(HGNC:CHRNB2)) |
33 | HBP00312 | BEL | complex(p(HGNC:CHRNA3), p(HGNC:CHRNB4)) |